C16H24O6 — CID 173015921
acetyl acetate;3-oct-1-enyloxolane-2,5-dione (PubChem CID 173015921) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is acetyl acetate;3-oct-1-enyloxolane-2,5-dione.
| Compound Name | acetyl acetate;3-oct-1-enyloxolane-2,5-dione |
|---|---|
| PubChem CID | 173015921 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | acetyl acetate;3-oct-1-enyloxolane-2,5-dione |
| SMILES | CC(=O)OC(C)=O.CCCCCCC=CC1CC(=O)OC1=O |
| InChI | InChI=1S/C12H18O3.C4H6O3/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14;1-3(5)7-4(2)6/h7-8,10H,2-6,9H2,1H3;1-2H3 |
| InChIKey | BDYQEWINRNOYEU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|