C21H26O4 — CID 175584644
3-oct-1-enyloxolane-2,5-dione;3-phenylprop-2-enal (PubChem CID 175584644) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-oct-1-enyloxolane-2,5-dione;3-phenylprop-2-enal.
| Compound Name | 3-oct-1-enyloxolane-2,5-dione;3-phenylprop-2-enal |
|---|---|
| PubChem CID | 175584644 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-oct-1-enyloxolane-2,5-dione;3-phenylprop-2-enal |
| SMILES | CCCCCCC=CC1CC(=O)OC1=O.O=CC=Cc1ccccc1 |
| InChI | InChI=1S/C12H18O3.C9H8O/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14;10-8-4-7-9-5-2-1-3-6-9/h7-8,10H,2-6,9H2,1H3;1-8H |
| InChIKey | NCLRCXCXMUHXPM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|