C20H28O6 — CID 174675000
3-dodec-1-enyloxolane-2,5-dione;furan-2,5-dione (PubChem CID 174675000) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 3-dodec-1-enyloxolane-2,5-dione;furan-2,5-dione.
| Compound Name | 3-dodec-1-enyloxolane-2,5-dione;furan-2,5-dione |
|---|---|
| PubChem CID | 174675000 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-dodec-1-enyloxolane-2,5-dione;furan-2,5-dione |
| SMILES | CCCCCCCCCCC=CC1CC(=O)OC1=O.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C16H26O3.C4H2O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18;5-3-1-2-4(6)7-3/h11-12,14H,2-10,13H2,1H3;1-2H |
| InChIKey | NVMTYAWAZOHYLV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|