C16H27NaO3 — CID 174902776
sodium;3-dodec-1-enyloxolane-2,5-dione;hydride (PubChem CID 174902776) has the molecular formula C16H27NaO3 and a molecular weight of 290.38 g/mol. Its IUPAC name is sodium;3-dodec-1-enyloxolane-2,5-dione;hydride.
| Compound Name | sodium;3-dodec-1-enyloxolane-2,5-dione;hydride |
|---|---|
| PubChem CID | 174902776 |
| Molecular Formula | C16H27NaO3 |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | sodium;3-dodec-1-enyloxolane-2,5-dione;hydride |
| SMILES | CCCCCCCCCCC=CC1CC(=O)OC1=O.[H-].[Na+] |
| InChI | InChI=1S/C16H26O3.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18;;/h11-12,14H,2-10,13H2,1H3;;/q;+1;-1 |
| InChIKey | CMLPGLQMTKCHJC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|