C25H44O3 — CID 101277064
3-[(E)-henicos-10-enyl]oxolane-2,5-dione (PubChem CID 101277064) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is 3-[(E)-henicos-10-enyl]oxolane-2,5-dione.
| Compound Name | 3-[(E)-henicos-10-enyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 101277064 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | 3-[(E)-henicos-10-enyl]oxolane-2,5-dione |
| SMILES | CCCCCCCCCC/C=C/CCCCCCCCCC1CC(=O)OC1=O |
| InChI | InChI=1S/C25H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-22-24(26)28-25(23)27/h11-12,23H,2-10,13-22H2,1H3/b12-11+ |
| InChIKey | PTCOXIDDWXPJIO-VAWYXSNFSA-N |
| XLogP | 7.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|