C15H20O6 — CID 59893092
3-[7-(2,5-dioxooxolan-3-yl)heptyl]oxolane-2,5-dione (PubChem CID 59893092) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-[7-(2,5-dioxooxolan-3-yl)heptyl]oxolane-2,5-dione.
| Compound Name | 3-[7-(2,5-dioxooxolan-3-yl)heptyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 59893092 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-[7-(2,5-dioxooxolan-3-yl)heptyl]oxolane-2,5-dione |
| SMILES | O=C1CC(CCCCCCCC2CC(=O)OC2=O)C(=O)O1 |
| InChI | InChI=1S/C15H20O6/c16-12-8-10(14(18)20-12)6-4-2-1-3-5-7-11-9-13(17)21-15(11)19/h10-11H,1-9H2 |
| InChIKey | OJRBQQUFZMLTAK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|