C16H28O5 — CID 162186164
1,4-dioxane;3-octyloxolane-2,5-dione (PubChem CID 162186164) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1,4-dioxane;3-octyloxolane-2,5-dione.
| Compound Name | 1,4-dioxane;3-octyloxolane-2,5-dione |
|---|---|
| PubChem CID | 162186164 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1,4-dioxane;3-octyloxolane-2,5-dione |
| SMILES | C1COCCO1.CCCCCCCCC1CC(=O)OC1=O |
| InChI | InChI=1S/C12H20O3.C4H8O2/c1-2-3-4-5-6-7-8-10-9-11(13)15-12(10)14;1-2-6-4-3-5-1/h10H,2-9H2,1H3;1-4H2 |
| InChIKey | ZPRICCXQUMOBDL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|