C20H36O3 — CID 141399157
3-(6,12-dimethyltetradecyl)oxolane-2,5-dione (PubChem CID 141399157) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is 3-(6,12-dimethyltetradecyl)oxolane-2,5-dione.
| Compound Name | 3-(6,12-dimethyltetradecyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 141399157 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 3-(6,12-dimethyltetradecyl)oxolane-2,5-dione |
| SMILES | CCC(C)CCCCCC(C)CCCCCC1CC(=O)OC1=O |
| InChI | InChI=1S/C20H36O3/c1-4-16(2)11-7-5-8-12-17(3)13-9-6-10-14-18-15-19(21)23-20(18)22/h16-18H,4-15H2,1-3H3 |
| InChIKey | AFXUYVIYNLTOEJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|