C12H19NO3 — CID 141287345
8-(2,5-dioxopyrrolidin-3-yl)octanal (PubChem CID 141287345) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 8-(2,5-dioxopyrrolidin-3-yl)octanal.
| Compound Name | 8-(2,5-dioxopyrrolidin-3-yl)octanal |
|---|---|
| PubChem CID | 141287345 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 8-(2,5-dioxopyrrolidin-3-yl)octanal |
| SMILES | O=CCCCCCCCC1CC(=O)NC1=O |
| InChI | InChI=1S/C12H19NO3/c14-8-6-4-2-1-3-5-7-10-9-11(15)13-12(10)16/h8,10H,1-7,9H2,(H,13,15,16) |
| InChIKey | XMNQVZALKGGVFM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|