About 8-(2,5-dioxopyrrolidin-3-yl)octanal
8-(2,5-dioxopyrrolidin-3-yl)octanal (PubChem CID 141287345) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is 8-(2,5-dioxopyrrolidin-3-yl)octanal.
Molecular Properties
| Compound Name | 8-(2,5-dioxopyrrolidin-3-yl)octanal |
| PubChem CID | 141287345 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 8-(2,5-dioxopyrrolidin-3-yl)octanal |
| SMILES | O=CCCCCCCCC1CC(=O)NC1=O |
| InChI | InChI=1S/C12H19NO3/c14-8-6-4-2-1-3-5-7-10-9-11(15)13-12(10)16/h8,10H,1-7,9H2,(H,13,15,16) |
| InChIKey | XMNQVZALKGGVFM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,5-dioxopyrrolidin-3-yl)octanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,5-dioxopyrrolidin-3-yl)octanal?
The IUPAC name of 8-(2,5-dioxopyrrolidin-3-yl)octanal (CID 141287345) is 8-(2,5-dioxopyrrolidin-3-yl)octanal.
What is the SMILES notation for 8-(2,5-dioxopyrrolidin-3-yl)octanal?
The canonical SMILES for 8-(2,5-dioxopyrrolidin-3-yl)octanal is O=CCCCCCCCC1CC(=O)NC1=O.
What is the InChIKey of 8-(2,5-dioxopyrrolidin-3-yl)octanal?
The InChIKey is XMNQVZALKGGVFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c14-8-6-4-2-1-3-5-7-10-9-11(15)13-12(10)16/h8,10H,1-7,9H2,(H,13,15,16).
What are the key properties of 8-(2,5-dioxopyrrolidin-3-yl)octanal?
8-(2,5-dioxopyrrolidin-3-yl)octanal has a molecular weight of 225.29 g/mol, XLogP of 1.58, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,5-dioxopyrrolidin-3-yl)octanal is sourced from PubChem (CID 141287345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).