C11H14N2O6S2 — CID 87423107
3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione;propanoic acid (PubChem CID 87423107) has the molecular formula C11H14N2O6S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione;propanoic acid.
| Compound Name | 3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione;propanoic acid |
|---|---|
| PubChem CID | 87423107 |
| Molecular Formula | C11H14N2O6S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione;propanoic acid |
| SMILES | CCC(=O)O.O=C1CC(SSC2CC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C8H8N2O4S2.C3H6O2/c11-5-1-3(7(13)9-5)15-16-4-2-6(12)10-8(4)14;1-2-3(4)5/h3-4H,1-2H2,(H,9,11,13)(H,10,12,14);2H2,1H3,(H,4,5) |
| InChIKey | VIOPTNLZHJWISL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|