C8H8N2O4S2 — CID 21182567
3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione (PubChem CID 21182567) has the molecular formula C8H8N2O4S2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione.
| Compound Name | 3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 21182567 |
| Molecular Formula | C8H8N2O4S2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 3-[(2,5-dioxopyrrolidin-3-yl)disulfanyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(SSC2CC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C8H8N2O4S2/c11-5-1-3(7(13)9-5)15-16-4-2-6(12)10-8(4)14/h3-4H,1-2H2,(H,9,11,13)(H,10,12,14) |
| InChIKey | AEZNJDZKJCAEMS-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|