C10H13N3O4S2 — CID 129044766
3-[(2,5-dioxopyrrolidin-3-yl)sulfanyl-methylamino]sulfanyl-1-methylpyrrolidine-2,5-dione (PubChem CID 129044766) has the molecular formula C10H13N3O4S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-[(2,5-dioxopyrrolidin-3-yl)sulfanyl-methylamino]sulfanyl-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3-[(2,5-dioxopyrrolidin-3-yl)sulfanyl-methylamino]sulfanyl-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 129044766 |
| Molecular Formula | C10H13N3O4S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-[(2,5-dioxopyrrolidin-3-yl)sulfanyl-methylamino]sulfanyl-1-methylpyrrolidine-2,5-dione |
| SMILES | CN(SC1CC(=O)NC1=O)SC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C10H13N3O4S2/c1-12-8(15)4-6(10(12)17)19-13(2)18-5-3-7(14)11-9(5)16/h5-6H,3-4H2,1-2H3,(H,11,14,16) |
| InChIKey | STNAYYAUYNYCJH-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|