C12H18N2O4S2 — CID 160581032
methanethiol;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione (PubChem CID 160581032) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is methanethiol;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione.
| Compound Name | methanethiol;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 160581032 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | methanethiol;1-methyl-3-methylsulfanylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
| SMILES | CN1C(=O)C=CC1=O.CS.CSC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H9NO2S.C5H5NO2.CH4S/c1-7-5(8)3-4(10-2)6(7)9;1-6-4(7)2-3-5(6)8;1-2/h4H,3H2,1-2H3;2-3H,1H3;2H,1H3 |
| InChIKey | RBTZSEYIEPPJML-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|