C5H6ClNO2S — CID 142806162
1-chloro-3-methylsulfanylpyrrolidine-2,5-dione (PubChem CID 142806162) has the molecular formula C5H6ClNO2S and a molecular weight of 179.63 g/mol. Its IUPAC name is 1-chloro-3-methylsulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-chloro-3-methylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142806162 |
| Molecular Formula | C5H6ClNO2S |
| Molecular Weight | 179.63 g/mol |
| Exact Mass | 178.98 |
| IUPAC Name | 1-chloro-3-methylsulfanylpyrrolidine-2,5-dione |
| SMILES | CSC1CC(=O)N(Cl)C1=O |
| InChI | InChI=1S/C5H6ClNO2S/c1-10-3-2-4(8)7(6)5(3)9/h3H,2H2,1H3 |
| InChIKey | HVRUMWMSAXPNKL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.63 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|