C8H12N2O3S — CID 122418919
3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 122418919) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | 3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 122418919 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CSC1CC(=O)N(CCC(N)=O)C1=O |
| InChI | InChI=1S/C8H12N2O3S/c1-14-5-4-7(12)10(8(5)13)3-2-6(9)11/h5H,2-4H2,1H3,(H2,9,11) |
| InChIKey | CMJQTLXXCJMWKL-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|