C16H33NO2S — CID 142573296
ethane;1-heptyl-3-methylsulfanylpyrrolidine-2,5-dione (PubChem CID 142573296) has the molecular formula C16H33NO2S and a molecular weight of 303.51 g/mol. Its IUPAC name is ethane;1-heptyl-3-methylsulfanylpyrrolidine-2,5-dione.
| Compound Name | ethane;1-heptyl-3-methylsulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142573296 |
| Molecular Formula | C16H33NO2S |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | ethane;1-heptyl-3-methylsulfanylpyrrolidine-2,5-dione |
| SMILES | CC.CC.CCCCCCCN1C(=O)CC(SC)C1=O |
| InChI | InChI=1S/C12H21NO2S.2C2H6/c1-3-4-5-6-7-8-13-11(14)9-10(16-2)12(13)15;2*1-2/h10H,3-9H2,1-2H3;2*1-2H3 |
| InChIKey | BNVFDWHYRRIHDM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|