C11H21NO2S — CID 143784408
ethane;1-pentyl-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 143784408) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is ethane;1-pentyl-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | ethane;1-pentyl-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143784408 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | ethane;1-pentyl-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | CC.CCCCCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C9H15NO2S.C2H6/c1-2-3-4-5-10-8(11)6-7(13)9(10)12;1-2/h7,13H,2-6H2,1H3;1-2H3 |
| InChIKey | VXBNCJKFHCHQLM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|