C9H15NO2 — CID 98085422
(3S)-1-butyl-3-methylpyrrolidine-2,5-dione (PubChem CID 98085422) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (3S)-1-butyl-3-methylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-butyl-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 98085422 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (3S)-1-butyl-3-methylpyrrolidine-2,5-dione |
| SMILES | CCCCN1C(=O)C[C@H](C)C1=O |
| InChI | InChI=1S/C9H15NO2/c1-3-4-5-10-8(11)6-7(2)9(10)12/h7H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | MAXADQYJXGNHJC-ZETCQYMHSA-N |
| XLogP | 1.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|