C9H13NO3 — CID 142459626
4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanal (PubChem CID 142459626) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanal.
| Compound Name | 4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanal |
|---|---|
| PubChem CID | 142459626 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 4-(3-methyl-2,5-dioxopyrrolidin-1-yl)butanal |
| SMILES | CC1CC(=O)N(CCCC=O)C1=O |
| InChI | InChI=1S/C9H13NO3/c1-7-6-8(12)10(9(7)13)4-2-3-5-11/h5,7H,2-4,6H2,1H3 |
| InChIKey | CKHDKMAHMOBACK-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|