C10H15NO3S — CID 139380902
6-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)hexanal (PubChem CID 139380902) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)hexanal.
| Compound Name | 6-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)hexanal |
|---|---|
| PubChem CID | 139380902 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 6-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)hexanal |
| SMILES | O=CCCCCCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C10H15NO3S/c12-6-4-2-1-3-5-11-9(13)7-8(15)10(11)14/h6,8,15H,1-5,7H2 |
| InChIKey | BNCNQIOFYKBMAT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|