C12H16N6O4S — CID 145431017
[6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propyl]-1,2,4,5-tetrazin-3-yl]methyl-methylcarbamic acid (PubChem CID 145431017) has the molecular formula C12H16N6O4S and a molecular weight of 340.37 g/mol. Its IUPAC name is [6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propyl]-1,2,4,5-tetrazin-3-yl]methyl-methylcarbamic acid.
| Compound Name | [6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propyl]-1,2,4,5-tetrazin-3-yl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 145431017 |
| Molecular Formula | C12H16N6O4S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [6-[3-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)propyl]-1,2,4,5-tetrazin-3-yl]methyl-methylcarbamic acid |
| SMILES | CN(Cc1nnc(CCCN2C(=O)CC(S)C2=O)nn1)C(=O)O |
| InChI | InChI=1S/C12H16N6O4S/c1-17(12(21)22)6-9-15-13-8(14-16-9)3-2-4-18-10(19)5-7(23)11(18)20/h7,23H,2-6H2,1H3,(H,21,22) |
| InChIKey | XCGNQWYJYVHBCK-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|