C17H26N2O7S — CID 164585890
1-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 164585890) has the molecular formula C17H26N2O7S and a molecular weight of 402.47 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 164585890 |
| Molecular Formula | C17H26N2O7S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[2-[2-[2-[2-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(CCOCCOCCOCCN2C(=O)CC(S)C2=O)C1=O |
| InChI | InChI=1S/C17H26N2O7S/c1-12-10-14(20)18(16(12)22)2-4-24-6-8-26-9-7-25-5-3-19-15(21)11-13(27)17(19)23/h12-13,27H,2-11H2,1H3 |
| InChIKey | RDAWFDFFXMQICF-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|