C18H35N3O7 — CID 165403649
N-[2-[hydroxy(methyl)amino]ethyl]formamide;3-methyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]pyrrolidine-2,5-dione (PubChem CID 165403649) has the molecular formula C18H35N3O7 and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[2-[hydroxy(methyl)amino]ethyl]formamide;3-methyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]pyrrolidine-2,5-dione.
| Compound Name | N-[2-[hydroxy(methyl)amino]ethyl]formamide;3-methyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 165403649 |
| Molecular Formula | C18H35N3O7 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | N-[2-[hydroxy(methyl)amino]ethyl]formamide;3-methyl-1-[2-[2-(2-propoxyethoxy)ethoxy]ethyl]pyrrolidine-2,5-dione |
| SMILES | CCCOCCOCCOCCN1C(=O)CC(C)C1=O.CN(O)CCNC=O |
| InChI | InChI=1S/C14H25NO5.C4H10N2O2/c1-3-5-18-7-9-20-10-8-19-6-4-15-13(16)11-12(2)14(15)17;1-6(8)3-2-5-4-7/h12H,3-11H2,1-2H3;4,8H,2-3H2,1H3,(H,5,7) |
| InChIKey | HTDDXSAFHRCYBG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|