C8H14N2O2 — CID 54496273
3-methyl-1-[2-(methylamino)ethyl]pyrrolidine-2,5-dione (PubChem CID 54496273) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-methyl-1-[2-(methylamino)ethyl]pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-1-[2-(methylamino)ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54496273 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-methyl-1-[2-(methylamino)ethyl]pyrrolidine-2,5-dione |
| SMILES | CNCCN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C8H14N2O2/c1-6-5-7(11)10(8(6)12)4-3-9-2/h6,9H,3-5H2,1-2H3 |
| InChIKey | XZIJSIZMJBSYDL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|