C17H33NO2 — CID 163913553
3-methyl-1-propylpyrrolidine-2,5-dione;nonane (PubChem CID 163913553) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 3-methyl-1-propylpyrrolidine-2,5-dione;nonane.
| Compound Name | 3-methyl-1-propylpyrrolidine-2,5-dione;nonane |
|---|---|
| PubChem CID | 163913553 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 3-methyl-1-propylpyrrolidine-2,5-dione;nonane |
| SMILES | CCCCCCCCC.CCCN1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C9H20.C8H13NO2/c1-3-5-7-9-8-6-4-2;1-3-4-9-7(10)5-6(2)8(9)11/h3-9H2,1-2H3;6H,3-5H2,1-2H3 |
| InChIKey | QUGVVQVGLXCCAS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|