C9H15NO2S — CID 143784409
1-pentyl-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 143784409) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 1-pentyl-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-pentyl-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143784409 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-pentyl-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | CCCCCN1C(=O)CC(S)C1=O |
| InChI | InChI=1S/C9H15NO2S/c1-2-3-4-5-10-8(11)6-7(13)9(10)12/h7,13H,2-6H2,1H3 |
| InChIKey | HXPQAUYNTUMLOA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|