C13H23NO2S — CID 142573295
3-ethylsulfanyl-1-heptylpyrrolidine-2,5-dione (PubChem CID 142573295) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 3-ethylsulfanyl-1-heptylpyrrolidine-2,5-dione.
| Compound Name | 3-ethylsulfanyl-1-heptylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 142573295 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-ethylsulfanyl-1-heptylpyrrolidine-2,5-dione |
| SMILES | CCCCCCCN1C(=O)CC(SCC)C1=O |
| InChI | InChI=1S/C13H23NO2S/c1-3-5-6-7-8-9-14-12(15)10-11(13(14)16)17-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | PUDPOHWNODDFNP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|