C18H34N2O3S — CID 144887232
6-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)-N-pentylhexanamide;molecular hydrogen (PubChem CID 144887232) has the molecular formula C18H34N2O3S and a molecular weight of 358.55 g/mol. Its IUPAC name is 6-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)-N-pentylhexanamide;molecular hydrogen.
| Compound Name | 6-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)-N-pentylhexanamide;molecular hydrogen |
|---|---|
| PubChem CID | 144887232 |
| Molecular Formula | C18H34N2O3S |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 6-(2,5-dioxo-3-propylsulfanylpyrrolidin-1-yl)-N-pentylhexanamide;molecular hydrogen |
| SMILES | CCCCCNC(=O)CCCCCN1C(=O)CC(SCCC)C1=O.[H][H] |
| InChI | InChI=1S/C18H32N2O3S.H2/c1-3-5-8-11-19-16(21)10-7-6-9-12-20-17(22)14-15(18(20)23)24-13-4-2;/h15H,3-14H2,1-2H3,(H,19,21);1H |
| InChIKey | QHAXUIRJWMYBKE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|