C17H28FN3O4S — CID 154975677
6-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoyl fluoride (PubChem CID 154975677) has the molecular formula C17H28FN3O4S and a molecular weight of 389.49 g/mol. Its IUPAC name is 6-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoyl fluoride.
| Compound Name | 6-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoyl fluoride |
|---|---|
| PubChem CID | 154975677 |
| Molecular Formula | C17H28FN3O4S |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 6-[3-[2-(5-aminopentylamino)-2-oxoethyl]sulfanyl-2,5-dioxopyrrolidin-1-yl]hexanoyl fluoride |
| SMILES | NCCCCCNC(=O)CSC1CC(=O)N(CCCCCC(=O)F)C1=O |
| InChI | InChI=1S/C17H28FN3O4S/c18-14(22)7-3-1-6-10-21-16(24)11-13(17(21)25)26-12-15(23)20-9-5-2-4-8-19/h13H,1-12,19H2,(H,20,23) |
| InChIKey | MVQDGTWLPHRLJG-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|