C21H38N2O3S — CID 139318601
N-(3-methylbutyl)-3-[3-(7-methyloctylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanamide (PubChem CID 139318601) has the molecular formula C21H38N2O3S and a molecular weight of 398.61 g/mol. Its IUPAC name is N-(3-methylbutyl)-3-[3-(7-methyloctylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanamide.
| Compound Name | N-(3-methylbutyl)-3-[3-(7-methyloctylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 139318601 |
| Molecular Formula | C21H38N2O3S |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | N-(3-methylbutyl)-3-[3-(7-methyloctylsulfanyl)-2,5-dioxopyrrolidin-1-yl]propanamide |
| SMILES | CC(C)CCCCCCSC1CC(=O)N(CCC(=O)NCCC(C)C)C1=O |
| InChI | InChI=1S/C21H38N2O3S/c1-16(2)9-7-5-6-8-14-27-18-15-20(25)23(21(18)26)13-11-19(24)22-12-10-17(3)4/h16-18H,5-15H2,1-4H3,(H,22,24) |
| InChIKey | FMFBKFSLOADICT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|