C17H29FN2O4S2 — CID 178026723
[1-[3-[2-(6-methyl-2-sulfanylheptan-2-yl)oxyethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite (PubChem CID 178026723) has the molecular formula C17H29FN2O4S2 and a molecular weight of 408.56 g/mol. Its IUPAC name is [1-[3-[2-(6-methyl-2-sulfanylheptan-2-yl)oxyethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite.
| Compound Name | [1-[3-[2-(6-methyl-2-sulfanylheptan-2-yl)oxyethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite |
|---|---|
| PubChem CID | 178026723 |
| Molecular Formula | C17H29FN2O4S2 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [1-[3-[2-(6-methyl-2-sulfanylheptan-2-yl)oxyethylamino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite |
| SMILES | CC(C)CCCC(C)(S)OCCNC(=O)CCN1C(=O)CC(SF)C1=O |
| InChI | InChI=1S/C17H29FN2O4S2/c1-12(2)5-4-7-17(3,25)24-10-8-19-14(21)6-9-20-15(22)11-13(26-18)16(20)23/h12-13,25H,4-11H2,1-3H3,(H,19,21) |
| InChIKey | ZVKAVHFTQVAQBJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|