C16H27N3O5S — CID 126672402
3-[3-(2-amino-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-(3-ethoxy-3-methylbutyl)propanamide (PubChem CID 126672402) has the molecular formula C16H27N3O5S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-[3-(2-amino-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-(3-ethoxy-3-methylbutyl)propanamide.
| Compound Name | 3-[3-(2-amino-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-(3-ethoxy-3-methylbutyl)propanamide |
|---|---|
| PubChem CID | 126672402 |
| Molecular Formula | C16H27N3O5S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-[3-(2-amino-2-oxoethyl)sulfanyl-2,5-dioxopyrrolidin-1-yl]-N-(3-ethoxy-3-methylbutyl)propanamide |
| SMILES | CCOC(C)(C)CCNC(=O)CCN1C(=O)CC(SCC(N)=O)C1=O |
| InChI | InChI=1S/C16H27N3O5S/c1-4-24-16(2,3)6-7-18-13(21)5-8-19-14(22)9-11(15(19)23)25-10-12(17)20/h11H,4-10H2,1-3H3,(H2,17,20)(H,18,21) |
| InChIKey | XPABKLGKNMEUCW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|