C14H25N3O4S — CID 130471010
N-[3-(aminomethoxy)-3-methylbutyl]-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 130471010) has the molecular formula C14H25N3O4S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[3-(aminomethoxy)-3-methylbutyl]-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[3-(aminomethoxy)-3-methylbutyl]-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 130471010 |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[3-(aminomethoxy)-3-methylbutyl]-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CSC1CC(=O)N(CCC(=O)NCCC(C)(C)OCN)C1=O |
| InChI | InChI=1S/C14H25N3O4S/c1-14(2,21-9-15)5-6-16-11(18)4-7-17-12(19)8-10(22-3)13(17)20/h10H,4-9,15H2,1-3H3,(H,16,18) |
| InChIKey | MVQJCYNNWVCEET-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|