C23H42N2O4 — CID 170010835
3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-[3-methyl-3-(3,3,4-trimethylpentoxy)butyl]propanamide (PubChem CID 170010835) has the molecular formula C23H42N2O4 and a molecular weight of 410.60 g/mol. Its IUPAC name is 3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-[3-methyl-3-(3,3,4-trimethylpentoxy)butyl]propanamide.
| Compound Name | 3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-[3-methyl-3-(3,3,4-trimethylpentoxy)butyl]propanamide |
|---|---|
| PubChem CID | 170010835 |
| Molecular Formula | C23H42N2O4 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.31 |
| IUPAC Name | 3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-[3-methyl-3-(3,3,4-trimethylpentoxy)butyl]propanamide |
| SMILES | CC(C)C1CC(=O)N(CCC(=O)NCCC(C)(C)OCCC(C)(C)C(C)C)C1=O |
| InChI | InChI=1S/C23H42N2O4/c1-16(2)18-15-20(27)25(21(18)28)13-9-19(26)24-12-10-23(7,8)29-14-11-22(5,6)17(3)4/h16-18H,9-15H2,1-8H3,(H,24,26) |
| InChIKey | ZZTVMBPQNGBXLA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|