C20H36N2O4 — CID 171558009
4-[3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-3-methylbutoxy]-N-ethyl-4-methylpentanamide (PubChem CID 171558009) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is 4-[3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-3-methylbutoxy]-N-ethyl-4-methylpentanamide.
| Compound Name | 4-[3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-3-methylbutoxy]-N-ethyl-4-methylpentanamide |
|---|---|
| PubChem CID | 171558009 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 4-[3-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-3-methylbutoxy]-N-ethyl-4-methylpentanamide |
| SMILES | CCNC(=O)CCC(C)(C)OCCC(C)(C)N1C(=O)CC(C(C)C)C1=O |
| InChI | InChI=1S/C20H36N2O4/c1-8-21-16(23)9-10-20(6,7)26-12-11-19(4,5)22-17(24)13-15(14(2)3)18(22)25/h14-15H,8-13H2,1-7H3,(H,21,23) |
| InChIKey | ADSUKCOQSWPIFM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|