C15H24INO3 — CID 156889459
4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-2,2,4-trimethylpentanoyl iodide (PubChem CID 156889459) has the molecular formula C15H24INO3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-2,2,4-trimethylpentanoyl iodide.
| Compound Name | 4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-2,2,4-trimethylpentanoyl iodide |
|---|---|
| PubChem CID | 156889459 |
| Molecular Formula | C15H24INO3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-2,2,4-trimethylpentanoyl iodide |
| SMILES | CC(C)C1CC(=O)N(C(C)(C)CC(C)(C)C(=O)I)C1=O |
| InChI | InChI=1S/C15H24INO3/c1-9(2)10-7-11(18)17(12(10)19)15(5,6)8-14(3,4)13(16)20/h9-10H,7-8H2,1-6H3 |
| InChIKey | GAFJHDRJFBYYNX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|