C19H33NO3 — CID 134506977
3-hexyl-1-(2,4,4-trimethyl-5-oxohexan-2-yl)pyrrolidine-2,5-dione (PubChem CID 134506977) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 3-hexyl-1-(2,4,4-trimethyl-5-oxohexan-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-hexyl-1-(2,4,4-trimethyl-5-oxohexan-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134506977 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | 3-hexyl-1-(2,4,4-trimethyl-5-oxohexan-2-yl)pyrrolidine-2,5-dione |
| SMILES | CCCCCCC1CC(=O)N(C(C)(C)CC(C)(C)C(C)=O)C1=O |
| InChI | InChI=1S/C19H33NO3/c1-7-8-9-10-11-15-12-16(22)20(17(15)23)19(5,6)13-18(3,4)14(2)21/h15H,7-13H2,1-6H3 |
| InChIKey | XCUJAZQKIUASLM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|