C18H32N2O2S — CID 155383633
N-[4-(2,5-dioxo-3-pentylpyrrolidin-1-yl)butyl]-2,2-dimethylpropanethioamide (PubChem CID 155383633) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is N-[4-(2,5-dioxo-3-pentylpyrrolidin-1-yl)butyl]-2,2-dimethylpropanethioamide.
| Compound Name | N-[4-(2,5-dioxo-3-pentylpyrrolidin-1-yl)butyl]-2,2-dimethylpropanethioamide |
|---|---|
| PubChem CID | 155383633 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-[4-(2,5-dioxo-3-pentylpyrrolidin-1-yl)butyl]-2,2-dimethylpropanethioamide |
| SMILES | CCCCCC1CC(=O)N(CCCCNC(=S)C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H32N2O2S/c1-5-6-7-10-14-13-15(21)20(16(14)22)12-9-8-11-19-17(23)18(2,3)4/h14H,5-13H2,1-4H3,(H,19,23) |
| InChIKey | HGFXUYHWJUTUNS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|