C29H54N2O2S — CID 146228589
2-butyl-2-methyl-N-[4-[3-(2-methylhexan-2-yl)-2,5-dioxopyrrolidin-1-yl]butyl]nonanethioamide (PubChem CID 146228589) has the molecular formula C29H54N2O2S and a molecular weight of 494.83 g/mol. Its IUPAC name is 2-butyl-2-methyl-N-[4-[3-(2-methylhexan-2-yl)-2,5-dioxopyrrolidin-1-yl]butyl]nonanethioamide.
| Compound Name | 2-butyl-2-methyl-N-[4-[3-(2-methylhexan-2-yl)-2,5-dioxopyrrolidin-1-yl]butyl]nonanethioamide |
|---|---|
| PubChem CID | 146228589 |
| Molecular Formula | C29H54N2O2S |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 494.39 |
| IUPAC Name | 2-butyl-2-methyl-N-[4-[3-(2-methylhexan-2-yl)-2,5-dioxopyrrolidin-1-yl]butyl]nonanethioamide |
| SMILES | CCCCCCCC(C)(CCCC)C(=S)NCCCCN1C(=O)CC(C(C)(C)CCCC)C1=O |
| InChI | InChI=1S/C29H54N2O2S/c1-7-10-13-14-15-20-29(6,19-12-9-3)27(34)30-21-16-17-22-31-25(32)23-24(26(31)33)28(4,5)18-11-8-2/h24H,7-23H2,1-6H3,(H,30,34) |
| InChIKey | YFCAVDGHSZTDTG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|