C26H48N2O6 — CID 166462537
N-[2-[2-[2-(3-ethyl-3-methylpentoxy)ethoxy]ethoxy]ethyl]-3-[3-(2-methylbutan-2-yl)-2,5-dioxopyrrolidin-1-yl]propanamide (PubChem CID 166462537) has the molecular formula C26H48N2O6 and a molecular weight of 484.68 g/mol. Its IUPAC name is N-[2-[2-[2-(3-ethyl-3-methylpentoxy)ethoxy]ethoxy]ethyl]-3-[3-(2-methylbutan-2-yl)-2,5-dioxopyrrolidin-1-yl]propanamide.
| Compound Name | N-[2-[2-[2-(3-ethyl-3-methylpentoxy)ethoxy]ethoxy]ethyl]-3-[3-(2-methylbutan-2-yl)-2,5-dioxopyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 166462537 |
| Molecular Formula | C26H48N2O6 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.35 |
| IUPAC Name | N-[2-[2-[2-(3-ethyl-3-methylpentoxy)ethoxy]ethoxy]ethyl]-3-[3-(2-methylbutan-2-yl)-2,5-dioxopyrrolidin-1-yl]propanamide |
| SMILES | CCC(C)(CC)CCOCCOCCOCCNC(=O)CCN1C(=O)CC(C(C)(C)CC)C1=O |
| InChI | InChI=1S/C26H48N2O6/c1-7-25(4,5)21-20-23(30)28(24(21)31)13-10-22(29)27-12-15-33-17-19-34-18-16-32-14-11-26(6,8-2)9-3/h21H,7-20H2,1-6H3,(H,27,29) |
| InChIKey | KBHHIPRABLHDCY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|