C17H29N3O5 — CID 130193048
3-[2-[3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]butanamide (PubChem CID 130193048) has the molecular formula C17H29N3O5 and a molecular weight of 355.44 g/mol. Its IUPAC name is 3-[2-[3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]butanamide.
| Compound Name | 3-[2-[3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]butanamide |
|---|---|
| PubChem CID | 130193048 |
| Molecular Formula | C17H29N3O5 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 3-[2-[3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]ethoxy]butanamide |
| SMILES | CC(CC(N)=O)OCCNC(=O)CCN1C(=O)CC(C(C)(C)C)C1=O |
| InChI | InChI=1S/C17H29N3O5/c1-11(9-13(18)21)25-8-6-19-14(22)5-7-20-15(23)10-12(16(20)24)17(2,3)4/h11-12H,5-10H2,1-4H3,(H2,18,21)(H,19,22) |
| InChIKey | NGVWUMLNOOVBQY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|