C34H58N4O8 — CID 162456959
6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide (PubChem CID 162456959) has the molecular formula C34H58N4O8 and a molecular weight of 650.86 g/mol. Its IUPAC name is 6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide.
| Compound Name | 6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 162456959 |
| Molecular Formula | C34H58N4O8 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | 6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-[2-[2-[2-[6-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]ethoxy]ethoxy]ethyl]hexanamide |
| SMILES | CC(C)(C)C1CC(=O)N(CCCCCC(=O)NCCOCCOCCNC(=O)CCCCCN2C(=O)CC(C(C)(C)C)C2=O)C1=O |
| InChI | InChI=1S/C34H58N4O8/c1-33(2,3)25-23-29(41)37(31(25)43)17-11-7-9-13-27(39)35-15-19-45-21-22-46-20-16-36-28(40)14-10-8-12-18-38-30(42)24-26(32(38)44)34(4,5)6/h25-26H,7-24H2,1-6H3,(H,35,39)(H,36,40) |
| InChIKey | UUMPGMUTAXZXJQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|