C18H31N3O7S — CID 58290198
N-[2-[2-[2-(3-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)butanamide (PubChem CID 58290198) has the molecular formula C18H31N3O7S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[2-[2-[2-(3-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[2-[2-[2-(3-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 58290198 |
| Molecular Formula | C18H31N3O7S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-[2-[2-[2-(3-hydroxypropanoylamino)ethoxy]ethoxy]ethyl]-4-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)butanamide |
| SMILES | CSC1CC(=O)N(CCCC(=O)NCCOCCOCCNC(=O)CCO)C1=O |
| InChI | InChI=1S/C18H31N3O7S/c1-29-14-13-17(25)21(18(14)26)7-2-3-15(23)19-5-9-27-11-12-28-10-6-20-16(24)4-8-22/h14,22H,2-13H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | CIJNWNUQQQAOIN-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|