C16H26N2O5S — CID 159886019
N-[2-(7-deuterio-3-oxoheptoxy)ethyl]-2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 159886019) has the molecular formula C16H26N2O5S and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[2-(7-deuterio-3-oxoheptoxy)ethyl]-2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-[2-(7-deuterio-3-oxoheptoxy)ethyl]-2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 159886019 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[2-(7-deuterio-3-oxoheptoxy)ethyl]-2-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | [2H]CCCCC(=O)CCOCCNC(=O)CN1C(=O)CC(SC)C1=O |
| InChI | InChI=1S/C16H26N2O5S/c1-3-4-5-12(19)6-8-23-9-7-17-14(20)11-18-15(21)10-13(24-2)16(18)22/h13H,3-11H2,1-2H3,(H,17,20)/i1D |
| InChIKey | NUDLJYKKQHEECM-MICDWDOJSA-N |
| XLogP | 0.76 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|