C17H31N3O5S — CID 123603961
3-ethoxy-N-propylpropanamide;N-methyl-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 123603961) has the molecular formula C17H31N3O5S and a molecular weight of 389.52 g/mol. Its IUPAC name is 3-ethoxy-N-propylpropanamide;N-methyl-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | 3-ethoxy-N-propylpropanamide;N-methyl-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 123603961 |
| Molecular Formula | C17H31N3O5S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 3-ethoxy-N-propylpropanamide;N-methyl-3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | CCCNC(=O)CCOCC.CNC(=O)CCN1C(=O)CC(SC)C1=O |
| InChI | InChI=1S/C9H14N2O3S.C8H17NO2/c1-10-7(12)3-4-11-8(13)5-6(15-2)9(11)14;1-3-6-9-8(10)5-7-11-4-2/h6H,3-5H2,1-2H3,(H,10,12);3-7H2,1-2H3,(H,9,10) |
| InChIKey | UXHIRNPSNHJQFK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|