C28H49N3O7S — CID 158910983
3-[2-[6-[2,5-dioxo-3-[3-oxo-3-(pentylamino)propyl]sulfanylpyrrolidin-1-yl]-4-oxohexoxy]ethoxy]-N-pentylpropanamide (PubChem CID 158910983) has the molecular formula C28H49N3O7S and a molecular weight of 571.78 g/mol. Its IUPAC name is 3-[2-[6-[2,5-dioxo-3-[3-oxo-3-(pentylamino)propyl]sulfanylpyrrolidin-1-yl]-4-oxohexoxy]ethoxy]-N-pentylpropanamide.
| Compound Name | 3-[2-[6-[2,5-dioxo-3-[3-oxo-3-(pentylamino)propyl]sulfanylpyrrolidin-1-yl]-4-oxohexoxy]ethoxy]-N-pentylpropanamide |
|---|---|
| PubChem CID | 158910983 |
| Molecular Formula | C28H49N3O7S |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.33 |
| IUPAC Name | 3-[2-[6-[2,5-dioxo-3-[3-oxo-3-(pentylamino)propyl]sulfanylpyrrolidin-1-yl]-4-oxohexoxy]ethoxy]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCOCCOCCCC(=O)CCN1C(=O)CC(SCCC(=O)NCCCCC)C1=O |
| InChI | InChI=1S/C28H49N3O7S/c1-3-5-7-14-29-25(33)12-18-38-20-19-37-17-9-10-23(32)11-16-31-27(35)22-24(28(31)36)39-21-13-26(34)30-15-8-6-4-2/h24H,3-22H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | JGQJEWQCNYFLIQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|