C21H45N2O3PS — CID 145127902
3-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide;ethane (PubChem CID 145127902) has the molecular formula C21H45N2O3PS and a molecular weight of 436.64 g/mol. Its IUPAC name is 3-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide;ethane.
| Compound Name | 3-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide;ethane |
|---|---|
| PubChem CID | 145127902 |
| Molecular Formula | C21H45N2O3PS |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.29 |
| IUPAC Name | 3-(3-butylsulfanyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide;ethane |
| SMILES | CC.CC.CC.CCCCSC1CC(=O)N(CCC(=O)NCCP(C)C)C1=O |
| InChI | InChI=1S/C15H27N2O3PS.3C2H6/c1-4-5-10-22-12-11-14(19)17(15(12)20)8-6-13(18)16-7-9-21(2)3;3*1-2/h12H,4-11H2,1-3H3,(H,16,18);3*1-2H3 |
| InChIKey | FCKWTDNTYNFKIQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|