C15H27N2O3P — CID 145127897
3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide (PubChem CID 145127897) has the molecular formula C15H27N2O3P and a molecular weight of 314.37 g/mol. Its IUPAC name is 3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide.
| Compound Name | 3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide |
|---|---|
| PubChem CID | 145127897 |
| Molecular Formula | C15H27N2O3P |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 3-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)-N-(2-dimethylphosphanylethyl)propanamide |
| SMILES | CP(C)CCNC(=O)CCN1C(=O)CC(C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H27N2O3P/c1-15(2,3)11-10-13(19)17(14(11)20)8-6-12(18)16-7-9-21(4)5/h11H,6-10H2,1-5H3,(H,16,18) |
| InChIKey | WNWVIAHXFWJILM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|