C26H44N6O9 — CID 154623597
2-[4-[2-[2-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 154623597) has the molecular formula C26H44N6O9 and a molecular weight of 584.67 g/mol. Its IUPAC name is 2-[4-[2-[2-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4-[2-[2-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 154623597 |
| Molecular Formula | C26H44N6O9 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 2-[4-[2-[2-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)ethylamino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)(C)C1CC(=O)N(CCNC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)C1=O |
| InChI | InChI=1S/C26H44N6O9/c1-26(2,3)19-14-21(34)32(25(19)41)5-4-27-20(33)15-28-6-8-29(16-22(35)36)10-12-31(18-24(39)40)13-11-30(9-7-28)17-23(37)38/h19H,4-18H2,1-3H3,(H,27,33)(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | WXOPUSYZUDTCFC-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 191.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|