C21H36N2O4 — CID 164585932
1-[4-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)butyl]-3-propan-2-ylpyrrolidine-2,5-dione;ethane (PubChem CID 164585932) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is 1-[4-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)butyl]-3-propan-2-ylpyrrolidine-2,5-dione;ethane.
| Compound Name | 1-[4-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)butyl]-3-propan-2-ylpyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 164585932 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 1-[4-(3-tert-butyl-2,5-dioxopyrrolidin-1-yl)butyl]-3-propan-2-ylpyrrolidine-2,5-dione;ethane |
| SMILES | CC.CC(C)C1CC(=O)N(CCCCN2C(=O)CC(C(C)(C)C)C2=O)C1=O |
| InChI | InChI=1S/C19H30N2O4.C2H6/c1-12(2)13-10-15(22)20(17(13)24)8-6-7-9-21-16(23)11-14(18(21)25)19(3,4)5;1-2/h12-14H,6-11H2,1-5H3;1-2H3 |
| InChIKey | PGBCOWQWHDCOJK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|